C11H12INO3S2 — CID 79685551
2-ethyl-3-(5-iodothiophene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 79685551) has the molecular formula C11H12INO3S2 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-ethyl-3-(5-iodothiophene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-ethyl-3-(5-iodothiophene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 79685551 |
| Molecular Formula | C11H12INO3S2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 2-ethyl-3-(5-iodothiophene-3-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCC1SCC(C(=O)O)N1C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C11H12INO3S2/c1-2-9-13(7(5-18-9)11(15)16)10(14)6-3-8(12)17-4-6/h3-4,7,9H,2,5H2,1H3,(H,15,16) |
| InChIKey | RCFLOKAPBJBFAY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|