C15H15BrF2N2O — CID 63793142
4-bromo-N-[(2,5-difluorophenyl)methyl]-1-propylpyrrole-2-carboxamide (PubChem CID 63793142) has the molecular formula C15H15BrF2N2O and a molecular weight of 357.20 g/mol. Its IUPAC name is 4-bromo-N-[(2,5-difluorophenyl)methyl]-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(2,5-difluorophenyl)methyl]-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63793142 |
| Molecular Formula | C15H15BrF2N2O |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 4-bromo-N-[(2,5-difluorophenyl)methyl]-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H15BrF2N2O/c1-2-5-20-9-11(16)7-14(20)15(21)19-8-10-6-12(17)3-4-13(10)18/h3-4,6-7,9H,2,5,8H2,1H3,(H,19,21) |
| InChIKey | RXCWKYIPFBTXFE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |