C16H20BrN3O — CID 81093916
N-[[4-(aminomethyl)phenyl]methyl]-4-bromo-1-propylpyrrole-2-carboxamide (PubChem CID 81093916) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-4-bromo-1-propylpyrrole-2-carboxamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-4-bromo-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 81093916 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-4-bromo-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)NCc1ccc(CN)cc1 |
| InChI | InChI=1S/C16H20BrN3O/c1-2-7-20-11-14(17)8-15(20)16(21)19-10-13-5-3-12(9-18)4-6-13/h3-6,8,11H,2,7,9-10,18H2,1H3,(H,19,21) |
| InChIKey | YWXPEXPYFFPRAJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |