C16H20F2N2O — CID 63793595
2-cyano-N-[(2,5-difluorophenyl)methyl]-2-propylpentanamide (PubChem CID 63793595) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-cyano-N-[(2,5-difluorophenyl)methyl]-2-propylpentanamide.
| Compound Name | 2-cyano-N-[(2,5-difluorophenyl)methyl]-2-propylpentanamide |
|---|---|
| PubChem CID | 63793595 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-cyano-N-[(2,5-difluorophenyl)methyl]-2-propylpentanamide |
| SMILES | CCCC(C#N)(CCC)C(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C16H20F2N2O/c1-3-7-16(11-19,8-4-2)15(21)20-10-12-9-13(17)5-6-14(12)18/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,20,21) |
| InChIKey | HECLVHIGHPQYJT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |