C19H32N2 — CID 63794705
1-[4-(4,4-diethylpiperidin-1-yl)phenyl]butan-2-amine (PubChem CID 63794705) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-[4-(4,4-diethylpiperidin-1-yl)phenyl]butan-2-amine.
| Compound Name | 1-[4-(4,4-diethylpiperidin-1-yl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 63794705 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 1-[4-(4,4-diethylpiperidin-1-yl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(N2CCC(CC)(CC)CC2)cc1 |
| InChI | InChI=1S/C19H32N2/c1-4-17(20)15-16-7-9-18(10-8-16)21-13-11-19(5-2,6-3)12-14-21/h7-10,17H,4-6,11-15,20H2,1-3H3 |
| InChIKey | CRBMONDGIHLCKR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|