C19H32N2 — CID 65286543
1-[4-(4,4-dimethylazepan-1-yl)-3-methylphenyl]butan-2-amine (PubChem CID 65286543) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-[4-(4,4-dimethylazepan-1-yl)-3-methylphenyl]butan-2-amine.
| Compound Name | 1-[4-(4,4-dimethylazepan-1-yl)-3-methylphenyl]butan-2-amine |
|---|---|
| PubChem CID | 65286543 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 1-[4-(4,4-dimethylazepan-1-yl)-3-methylphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(N2CCCC(C)(C)CC2)c(C)c1 |
| InChI | InChI=1S/C19H32N2/c1-5-17(20)14-16-7-8-18(15(2)13-16)21-11-6-9-19(3,4)10-12-21/h7-8,13,17H,5-6,9-12,14,20H2,1-4H3 |
| InChIKey | FODHQCHTBLFLDQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |