About 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide
4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide (PubChem CID 63800844) has the molecular formula C9H13N3O2S
and a molecular weight of 227.29 g/mol. Its IUPAC name is 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide.
Molecular Properties
| Compound Name | 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide |
| PubChem CID | 63800844 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide |
| SMILES | Cn1ccc(=O)n(CCCC(N)=S)c1=O |
| InChI | InChI=1S/C9H13N3O2S/c1-11-6-4-8(13)12(9(11)14)5-2-3-7(10)15/h4,6H,2-3,5H2,1H3,(H2,10,15) |
| InChIKey | BYNLZVKWTMFDHR-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide?
The IUPAC name of 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide (CID 63800844) is 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide.
What is the SMILES notation for 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide?
The canonical SMILES for 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide is Cn1ccc(=O)n(CCCC(N)=S)c1=O.
What is the InChIKey of 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide?
The InChIKey is BYNLZVKWTMFDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S/c1-11-6-4-8(13)12(9(11)14)5-2-3-7(10)15/h4,6H,2-3,5H2,1H3,(H2,10,15).
What are the key properties of 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide?
4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide has a molecular weight of 227.29 g/mol, XLogP of -0.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-2,6-dioxopyrimidin-1-yl)butanethioamide is sourced from PubChem (CID 63800844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).