C19H18ClNO3 — CID 6380114
[(E)-3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-ylideneamino] 4-chlorobenzoate (PubChem CID 6380114) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is [(E)-3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-ylideneamino] 4-chlorobenzoate.
| Compound Name | [(E)-3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-ylideneamino] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6380114 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [(E)-3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-ylideneamino] 4-chlorobenzoate |
| SMILES | O=C(O/N=C1\CCCc2oc3c(c21)CCCC3)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClNO3/c20-13-10-8-12(9-11-13)19(22)24-21-15-5-3-7-17-18(15)14-4-1-2-6-16(14)23-17/h8-11H,1-7H2/b21-15+ |
| InChIKey | JHBJWKHTVYBFBZ-RCCKNPSSSA-N |
| XLogP | 4.71 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|