C20H19NO2 — CID 20843761
[(E)-[(2Z)-2-benzylidenecyclopentylidene]amino] 4-methylbenzoate (PubChem CID 20843761) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is [(E)-[(2Z)-2-benzylidenecyclopentylidene]amino] 4-methylbenzoate.
| Compound Name | [(E)-[(2Z)-2-benzylidenecyclopentylidene]amino] 4-methylbenzoate |
|---|---|
| PubChem CID | 20843761 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [(E)-[(2Z)-2-benzylidenecyclopentylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O/N=C2\CCC\C2=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO2/c1-15-10-12-17(13-11-15)20(22)23-21-19-9-5-8-18(19)14-16-6-3-2-4-7-16/h2-4,6-7,10-14H,5,8-9H2,1H3/b18-14-,21-19+ |
| InChIKey | JFHSIFOBUNRDQH-LEDZZQCTSA-N |
| XLogP | 4.78 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|