C19H28N2O — CID 134106823
N-[2-[(Z)-[(2E)-2-benzylidenecycloheptylidene]amino]oxyethyl]propan-2-amine (PubChem CID 134106823) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[2-[(Z)-[(2E)-2-benzylidenecycloheptylidene]amino]oxyethyl]propan-2-amine.
| Compound Name | N-[2-[(Z)-[(2E)-2-benzylidenecycloheptylidene]amino]oxyethyl]propan-2-amine |
|---|---|
| PubChem CID | 134106823 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-[2-[(Z)-[(2E)-2-benzylidenecycloheptylidene]amino]oxyethyl]propan-2-amine |
| SMILES | CC(C)NCCO/N=C1/CCCCC/C1=C\c1ccccc1 |
| InChI | InChI=1S/C19H28N2O/c1-16(2)20-13-14-22-21-19-12-8-4-7-11-18(19)15-17-9-5-3-6-10-17/h3,5-6,9-10,15-16,20H,4,7-8,11-14H2,1-2H3/b18-15+,21-19- |
| InChIKey | WYMJKVLDNHVXOY-YDDLXSOJSA-N |
| XLogP | 4.40 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|