C12H14N2OS — CID 63803177
2-butan-2-ylsulfanylimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 63803177) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-butan-2-ylsulfanylimidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-butan-2-ylsulfanylimidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 63803177 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-butan-2-ylsulfanylimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | CCC(C)Sc1nc2ccccn2c1C=O |
| InChI | InChI=1S/C12H14N2OS/c1-3-9(2)16-12-10(8-15)14-7-5-4-6-11(14)13-12/h4-9H,3H2,1-2H3 |
| InChIKey | UDSWNENFRSSQNW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|