C12H9N3OS2 — CID 63803375
2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 63803375) has the molecular formula C12H9N3OS2 and a molecular weight of 275.36 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 63803375 |
| Molecular Formula | C12H9N3OS2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | Cc1csc(Sc2nc3ccccn3c2C=O)n1 |
| InChI | InChI=1S/C12H9N3OS2/c1-8-7-17-12(13-8)18-11-9(6-16)15-5-3-2-4-10(15)14-11/h2-7H,1H3 |
| InChIKey | CXIRGMOPWANQBR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|