C10H12BrNO3S2 — CID 63804267
(2S)-2-[(3-bromothiophene-2-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 63804267) has the molecular formula C10H12BrNO3S2 and a molecular weight of 338.25 g/mol. Its IUPAC name is (2S)-2-[(3-bromothiophene-2-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(3-bromothiophene-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 63804267 |
| Molecular Formula | C10H12BrNO3S2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | (2S)-2-[(3-bromothiophene-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1sccc1Br)C(=O)O |
| InChI | InChI=1S/C10H12BrNO3S2/c1-16-4-3-7(10(14)15)12-9(13)8-6(11)2-5-17-8/h2,5,7H,3-4H2,1H3,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | ACNFRJOJHLUVRE-ZETCQYMHSA-N |
| XLogP | 2.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |