C15H20ClN3OS — CID 63804911
N-[[5-(2-chlorophenyl)sulfanyl-1,3-dimethylpyrazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 63804911) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)sulfanyl-1,3-dimethylpyrazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(2-chlorophenyl)sulfanyl-1,3-dimethylpyrazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63804911 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[[5-(2-chlorophenyl)sulfanyl-1,3-dimethylpyrazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c(C)nn(C)c1Sc1ccccc1Cl |
| InChI | InChI=1S/C15H20ClN3OS/c1-11-12(10-17-8-9-20-3)15(19(2)18-11)21-14-7-5-4-6-13(14)16/h4-7,17H,8-10H2,1-3H3 |
| InChIKey | SXLKLYWCFWPFGD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|