C14H17ClN2OS2 — CID 63806182
N-[[2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine (PubChem CID 63806182) has the molecular formula C14H17ClN2OS2 and a molecular weight of 328.89 g/mol. Its IUPAC name is N-[[2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63806182 |
| Molecular Formula | C14H17ClN2OS2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-[[2-chloro-6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c(Cl)cccc1Sc1nc(C)cs1 |
| InChI | InChI=1S/C14H17ClN2OS2/c1-10-9-19-14(17-10)20-13-5-3-4-12(15)11(13)8-16-6-7-18-2/h3-5,9,16H,6-8H2,1-2H3 |
| InChIKey | RRRJSWNDHVUMBB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|