C13H18FN5S — CID 63805045
N-[[3-fluoro-4-(1-methyltetrazol-5-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine (PubChem CID 63805045) has the molecular formula C13H18FN5S and a molecular weight of 295.39 g/mol. Its IUPAC name is N-[[3-fluoro-4-(1-methyltetrazol-5-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-fluoro-4-(1-methyltetrazol-5-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 63805045 |
| Molecular Formula | C13H18FN5S |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[[3-fluoro-4-(1-methyltetrazol-5-yl)sulfanylphenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(Sc2nnnn2C)c(F)c1 |
| InChI | InChI=1S/C13H18FN5S/c1-9(2)7-15-8-10-4-5-12(11(14)6-10)20-13-16-17-18-19(13)3/h4-6,9,15H,7-8H2,1-3H3 |
| InChIKey | KFPHLKUXFVUQSG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |