C13H18FNS — CID 63807534
N-[(5-fluoro-2-propan-2-ylsulfanylphenyl)methyl]cyclopropanamine (PubChem CID 63807534) has the molecular formula C13H18FNS and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(5-fluoro-2-propan-2-ylsulfanylphenyl)methyl]cyclopropanamine.
| Compound Name | N-[(5-fluoro-2-propan-2-ylsulfanylphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63807534 |
| Molecular Formula | C13H18FNS |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[(5-fluoro-2-propan-2-ylsulfanylphenyl)methyl]cyclopropanamine |
| SMILES | CC(C)Sc1ccc(F)cc1CNC1CC1 |
| InChI | InChI=1S/C13H18FNS/c1-9(2)16-13-6-3-11(14)7-10(13)8-15-12-4-5-12/h3,6-7,9,12,15H,4-5,8H2,1-2H3 |
| InChIKey | XMYRQZXLJSKJSM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |