C16H25FN2O — CID 81056751
2-[(cyclopropylamino)methyl]-4-fluoro-N-methyl-N-(2-propan-2-yloxyethyl)aniline (PubChem CID 81056751) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-4-fluoro-N-methyl-N-(2-propan-2-yloxyethyl)aniline.
| Compound Name | 2-[(cyclopropylamino)methyl]-4-fluoro-N-methyl-N-(2-propan-2-yloxyethyl)aniline |
|---|---|
| PubChem CID | 81056751 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-4-fluoro-N-methyl-N-(2-propan-2-yloxyethyl)aniline |
| SMILES | CC(C)OCCN(C)c1ccc(F)cc1CNC1CC1 |
| InChI | InChI=1S/C16H25FN2O/c1-12(2)20-9-8-19(3)16-7-4-14(17)10-13(16)11-18-15-5-6-15/h4,7,10,12,15,18H,5-6,8-9,11H2,1-3H3 |
| InChIKey | UQVLDDKSGMRPAR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |