C12H18FNS — CID 63808238
N-[(3-fluoro-4-propan-2-ylsulfanylphenyl)methyl]ethanamine (PubChem CID 63808238) has the molecular formula C12H18FNS and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[(3-fluoro-4-propan-2-ylsulfanylphenyl)methyl]ethanamine.
| Compound Name | N-[(3-fluoro-4-propan-2-ylsulfanylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63808238 |
| Molecular Formula | C12H18FNS |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[(3-fluoro-4-propan-2-ylsulfanylphenyl)methyl]ethanamine |
| SMILES | CCNCc1ccc(SC(C)C)c(F)c1 |
| InChI | InChI=1S/C12H18FNS/c1-4-14-8-10-5-6-12(11(13)7-10)15-9(2)3/h5-7,9,14H,4,8H2,1-3H3 |
| InChIKey | LYVWUTLGPZZOTF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |