C12H13FN2S2 — CID 63813747
N-[[3-fluoro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]ethanamine (PubChem CID 63813747) has the molecular formula C12H13FN2S2 and a molecular weight of 268.38 g/mol. Its IUPAC name is N-[[3-fluoro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]ethanamine.
| Compound Name | N-[[3-fluoro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63813747 |
| Molecular Formula | C12H13FN2S2 |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-[[3-fluoro-4-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(Sc2nccs2)c(F)c1 |
| InChI | InChI=1S/C12H13FN2S2/c1-2-14-8-9-3-4-11(10(13)7-9)17-12-15-5-6-16-12/h3-7,14H,2,8H2,1H3 |
| InChIKey | ZUTDGNZLQQKTBO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|