C13H23N3O2S — CID 63808561
ethyl 2-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]sulfanylacetate (PubChem CID 63808561) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is ethyl 2-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]sulfanylacetate.
| Compound Name | ethyl 2-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 63808561 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethyl 2-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]sulfanylacetate |
| SMILES | CCCNCc1c(C)nn(C)c1SCC(=O)OCC |
| InChI | InChI=1S/C13H23N3O2S/c1-5-7-14-8-11-10(3)15-16(4)13(11)19-9-12(17)18-6-2/h14H,5-9H2,1-4H3 |
| InChIKey | MDFYKYKAQNUZTI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|