C15H25N3O2 — CID 63812191
3-[3-(cyclopentylamino)propyl]-1-propylpyrimidine-2,4-dione (PubChem CID 63812191) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-[3-(cyclopentylamino)propyl]-1-propylpyrimidine-2,4-dione.
| Compound Name | 3-[3-(cyclopentylamino)propyl]-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63812191 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 3-[3-(cyclopentylamino)propyl]-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1ccc(=O)n(CCCNC2CCCC2)c1=O |
| InChI | InChI=1S/C15H25N3O2/c1-2-10-17-12-8-14(19)18(15(17)20)11-5-9-16-13-6-3-4-7-13/h8,12-13,16H,2-7,9-11H2,1H3 |
| InChIKey | LHUCTRHDQRWQLR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|