C9H9N5O4 — CID 63812274
1-(2-imidazol-1-ylethyl)-5-nitropyrimidine-2,4-dione (PubChem CID 63812274) has the molecular formula C9H9N5O4 and a molecular weight of 251.20 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-(2-imidazol-1-ylethyl)-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63812274 |
| Molecular Formula | C9H9N5O4 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)-5-nitropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCn2ccnc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O4/c15-8-7(14(17)18)5-13(9(16)11-8)4-3-12-2-1-10-6-12/h1-2,5-6H,3-4H2,(H,11,15,16) |
| InChIKey | DWCMXTAPSMHAFE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|