About (E)-3-bromoprop-2-enoic acid
(E)-3-bromoprop-2-enoic acid (PubChem CID 638125) has the molecular formula C3H3BrO2
and a molecular weight of 150.96 g/mol. Its IUPAC name is (E)-3-bromoprop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-bromoprop-2-enoic acid |
| PubChem CID | 638125 |
| Molecular Formula | C3H3BrO2 |
| Molecular Weight | 150.96 g/mol |
| Exact Mass | 149.93 |
| IUPAC Name | (E)-3-bromoprop-2-enoic acid |
| SMILES | O=C(O)/C=C/Br |
| InChI | InChI=1S/C3H3BrO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/b2-1+ |
| InChIKey | POAWTYXNXPEWCO-OWOJBTEDSA-N |
| XLogP | 0.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.96 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-bromoprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-bromoprop-2-enoic acid?
The IUPAC name of (E)-3-bromoprop-2-enoic acid (CID 638125) is (E)-3-bromoprop-2-enoic acid.
What is the SMILES notation for (E)-3-bromoprop-2-enoic acid?
The canonical SMILES for (E)-3-bromoprop-2-enoic acid is O=C(O)/C=C/Br.
What is the InChIKey of (E)-3-bromoprop-2-enoic acid?
The InChIKey is POAWTYXNXPEWCO-OWOJBTEDSA-N. The full InChI is InChI=1S/C3H3BrO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/b2-1+.
What are the key properties of (E)-3-bromoprop-2-enoic acid?
(E)-3-bromoprop-2-enoic acid has a molecular weight of 150.96 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-bromoprop-2-enoic acid is sourced from PubChem (CID 638125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).