C5H4Br2O — CID 54232728
1,5-dibromopenta-1,4-dien-3-one (PubChem CID 54232728) has the molecular formula C5H4Br2O and a molecular weight of 239.89 g/mol. Its IUPAC name is 1,5-dibromopenta-1,4-dien-3-one.
| Compound Name | 1,5-dibromopenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 54232728 |
| Molecular Formula | C5H4Br2O |
| Molecular Weight | 239.89 g/mol |
| Exact Mass | 237.86 |
| IUPAC Name | 1,5-dibromopenta-1,4-dien-3-one |
| SMILES | O=C(C=CBr)C=CBr |
| InChI | InChI=1S/C5H4Br2O/c6-3-1-5(8)2-4-7/h1-4H |
| InChIKey | QKKFOSWLROTDQG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.89 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|