C7H4O5-2 — CID 7019184
(5E)-4-oxohepta-2,5-dienedioate (PubChem CID 7019184) has the molecular formula C7H4O5-2 and a molecular weight of 168.10 g/mol. Its IUPAC name is (5E)-4-oxohepta-2,5-dienedioate.
| Compound Name | (5E)-4-oxohepta-2,5-dienedioate |
|---|---|
| PubChem CID | 7019184 |
| Molecular Formula | C7H4O5-2 |
| Molecular Weight | 168.10 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | (5E)-4-oxohepta-2,5-dienedioate |
| SMILES | O=C([O-])C=CC(=O)/C=C/C(=O)[O-] |
| InChI | InChI=1S/C7H6O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H,(H,9,10)(H,11,12)/p-2/b3-1+,4-2? |
| InChIKey | FORGRSMNOFWNBO-WZNPJAPVSA-L |
| XLogP | -2.83 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.10 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|