C11H9BrO2 — CID 175380964
1-bromo-5-(4-hydroxyphenyl)penta-1,4-dien-3-one (PubChem CID 175380964) has the molecular formula C11H9BrO2 and a molecular weight of 253.10 g/mol. Its IUPAC name is 1-bromo-5-(4-hydroxyphenyl)penta-1,4-dien-3-one.
| Compound Name | 1-bromo-5-(4-hydroxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 175380964 |
| Molecular Formula | C11H9BrO2 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 1-bromo-5-(4-hydroxyphenyl)penta-1,4-dien-3-one |
| SMILES | O=C(C=CBr)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C11H9BrO2/c12-8-7-11(14)6-3-9-1-4-10(13)5-2-9/h1-8,13H |
| InChIKey | CLVSXLFRUAMJNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|