C10H11N5O4 — CID 63812522
5-[(3-methyl-2,6-dioxopyrimidin-1-yl)methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63812522) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is 5-[(3-methyl-2,6-dioxopyrimidin-1-yl)methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(3-methyl-2,6-dioxopyrimidin-1-yl)methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63812522 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 5-[(3-methyl-2,6-dioxopyrimidin-1-yl)methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | Cn1ccc(=O)n(Cc2cc(C(=O)NN)no2)c1=O |
| InChI | InChI=1S/C10H11N5O4/c1-14-3-2-8(16)15(10(14)18)5-6-4-7(13-19-6)9(17)12-11/h2-4H,5,11H2,1H3,(H,12,17) |
| InChIKey | OYELRUXPQXAUOW-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|