C27H27I2N3O2 — CID 6381347
N-[(Z)-2-(4-butoxyphenyl)ethylideneamino]-3-(3,6-diiodocarbazol-9-yl)propanamide (PubChem CID 6381347) has the molecular formula C27H27I2N3O2 and a molecular weight of 679.34 g/mol. Its IUPAC name is N-[(Z)-2-(4-butoxyphenyl)ethylideneamino]-3-(3,6-diiodocarbazol-9-yl)propanamide.
| Compound Name | N-[(Z)-2-(4-butoxyphenyl)ethylideneamino]-3-(3,6-diiodocarbazol-9-yl)propanamide |
|---|---|
| PubChem CID | 6381347 |
| Molecular Formula | C27H27I2N3O2 |
| Molecular Weight | 679.34 g/mol |
| Exact Mass | 679.02 |
| IUPAC Name | N-[(Z)-2-(4-butoxyphenyl)ethylideneamino]-3-(3,6-diiodocarbazol-9-yl)propanamide |
| SMILES | CCCCOc1ccc(C/C=N\NC(=O)CCn2c3ccc(I)cc3c3cc(I)ccc32)cc1 |
| InChI | InChI=1S/C27H27I2N3O2/c1-2-3-16-34-22-8-4-19(5-9-22)12-14-30-31-27(33)13-15-32-25-10-6-20(28)17-23(25)24-18-21(29)7-11-26(24)32/h4-11,14,17-18H,2-3,12-13,15-16H2,1H3,(H,31,33)/b30-14- |
| InChIKey | VQSYAKBMXWCYND-CPDSRJINSA-N |
| XLogP | 6.92 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.34 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|