About N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine
N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 63814514) has the molecular formula C13H20N4S2
and a molecular weight of 296.46 g/mol. Its IUPAC name is N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 63814514 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | Cc1nn(C)c(Sc2nccs2)c1CNC(C)(C)C |
| InChI | InChI=1S/C13H20N4S2/c1-9-10(8-15-13(2,3)4)11(17(5)16-9)19-12-14-6-7-18-12/h6-7,15H,8H2,1-5H3 |
| InChIKey | RLQPVLUMXVYSCV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine (CID 63814514) is N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine is Cc1nn(C)c(Sc2nccs2)c1CNC(C)(C)C.
What is the InChIKey of N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine?
The InChIKey is RLQPVLUMXVYSCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4S2/c1-9-10(8-15-13(2,3)4)11(17(5)16-9)19-12-14-6-7-18-12/h6-7,15H,8H2,1-5H3.
What are the key properties of N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine?
N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine has a molecular weight of 296.46 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 63814514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).