C13H20N4S2 — CID 63814514
N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 63814514) has the molecular formula C13H20N4S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63814514 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-[[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | Cc1nn(C)c(Sc2nccs2)c1CNC(C)(C)C |
| InChI | InChI=1S/C13H20N4S2/c1-9-10(8-15-13(2,3)4)11(17(5)16-9)19-12-14-6-7-18-12/h6-7,15H,8H2,1-5H3 |
| InChIKey | RLQPVLUMXVYSCV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|