C17H20OS — CID 63814755
[4-(4-tert-butylphenyl)sulfanylphenyl]methanol (PubChem CID 63814755) has the molecular formula C17H20OS and a molecular weight of 272.41 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)sulfanylphenyl]methanol.
| Compound Name | [4-(4-tert-butylphenyl)sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 63814755 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [4-(4-tert-butylphenyl)sulfanylphenyl]methanol |
| SMILES | CC(C)(C)c1ccc(Sc2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C17H20OS/c1-17(2,3)14-6-10-16(11-7-14)19-15-8-4-13(12-18)5-9-15/h4-11,18H,12H2,1-3H3 |
| InChIKey | YNYXCPLYNHYZNC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |