C14H11F3OS — CID 63814899
(1R)-1-[2-(2,4-difluorophenyl)sulfanyl-6-fluorophenyl]ethanol (PubChem CID 63814899) has the molecular formula C14H11F3OS and a molecular weight of 284.30 g/mol. Its IUPAC name is (1R)-1-[2-(2,4-difluorophenyl)sulfanyl-6-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[2-(2,4-difluorophenyl)sulfanyl-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 63814899 |
| Molecular Formula | C14H11F3OS |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (1R)-1-[2-(2,4-difluorophenyl)sulfanyl-6-fluorophenyl]ethanol |
| SMILES | C[C@@H](O)c1c(F)cccc1Sc1ccc(F)cc1F |
| InChI | InChI=1S/C14H11F3OS/c1-8(18)14-10(16)3-2-4-13(14)19-12-6-5-9(15)7-11(12)17/h2-8,18H,1H3/t8-/m1/s1 |
| InChIKey | SSZVXEDBNAFSBR-MRVPVSSYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |