C15H15F2NS — CID 63818816
2-[4-(2,5-difluorophenyl)sulfanyl-3-methylphenyl]ethanamine (PubChem CID 63818816) has the molecular formula C15H15F2NS and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-[4-(2,5-difluorophenyl)sulfanyl-3-methylphenyl]ethanamine.
| Compound Name | 2-[4-(2,5-difluorophenyl)sulfanyl-3-methylphenyl]ethanamine |
|---|---|
| PubChem CID | 63818816 |
| Molecular Formula | C15H15F2NS |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[4-(2,5-difluorophenyl)sulfanyl-3-methylphenyl]ethanamine |
| SMILES | Cc1cc(CCN)ccc1Sc1cc(F)ccc1F |
| InChI | InChI=1S/C15H15F2NS/c1-10-8-11(6-7-18)2-5-14(10)19-15-9-12(16)3-4-13(15)17/h2-5,8-9H,6-7,18H2,1H3 |
| InChIKey | CMKLRUJFVHIDPU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |