C13H12F2N2S — CID 80651796
2-[6-(2,5-difluorophenyl)sulfanyl-3-pyridinyl]ethanamine (PubChem CID 80651796) has the molecular formula C13H12F2N2S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[6-(2,5-difluorophenyl)sulfanyl-3-pyridinyl]ethanamine.
| Compound Name | 2-[6-(2,5-difluorophenyl)sulfanyl-3-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 80651796 |
| Molecular Formula | C13H12F2N2S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[6-(2,5-difluorophenyl)sulfanyl-3-pyridinyl]ethanamine |
| SMILES | NCCc1ccc(Sc2cc(F)ccc2F)nc1 |
| InChI | InChI=1S/C13H12F2N2S/c14-10-2-3-11(15)12(7-10)18-13-4-1-9(5-6-16)8-17-13/h1-4,7-8H,5-6,16H2 |
| InChIKey | XLJBRYJHQVIJFR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |