C28H20N2O2 — CID 6382162
(2E)-2-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethanone (PubChem CID 6382162) has the molecular formula C28H20N2O2 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2E)-2-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2E)-2-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 6382162 |
| Molecular Formula | C28H20N2O2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (2E)-2-[(E)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethanone |
| SMILES | O=C(/C(=N/N=C(/C(=O)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H20N2O2/c31-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)29-30-26(22-15-7-2-8-16-22)28(32)24-19-11-4-12-20-24/h1-20H/b29-25+,30-26+ |
| InChIKey | KTIVNHNHGQMXFP-XDHTVYJESA-N |
| XLogP | 5.65 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|