C9H11N3O2S — CID 63824117
4-[2-(1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione (PubChem CID 63824117) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 4-[2-(1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione.
| Compound Name | 4-[2-(1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 63824117 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-[2-(1,3-thiazol-4-yl)ethyl]piperazine-2,6-dione |
| SMILES | O=C1CN(CCc2cscn2)CC(=O)N1 |
| InChI | InChI=1S/C9H11N3O2S/c13-8-3-12(4-9(14)11-8)2-1-7-5-15-6-10-7/h5-6H,1-4H2,(H,11,13,14) |
| InChIKey | WBLUJWPALCALOD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|