About 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine
4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine (PubChem CID 63824711) has the molecular formula C13H11ClN4S
and a molecular weight of 290.78 g/mol. Its IUPAC name is 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine.
Molecular Properties
| Compound Name | 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine |
| PubChem CID | 63824711 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine |
| SMILES | Clc1nnc(NCCc2cscn2)c2ccccc12 |
| InChI | InChI=1S/C13H11ClN4S/c14-12-10-3-1-2-4-11(10)13(18-17-12)15-6-5-9-7-19-8-16-9/h1-4,7-8H,5-6H2,(H,15,18) |
| InChIKey | CCIRFJLPNRBGFO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine?
The IUPAC name of 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine (CID 63824711) is 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine.
What is the SMILES notation for 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine?
The canonical SMILES for 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine is Clc1nnc(NCCc2cscn2)c2ccccc12.
What is the InChIKey of 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine?
The InChIKey is CCIRFJLPNRBGFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4S/c14-12-10-3-1-2-4-11(10)13(18-17-12)15-6-5-9-7-19-8-16-9/h1-4,7-8H,5-6H2,(H,15,18).
What are the key properties of 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine?
4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine has a molecular weight of 290.78 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine is sourced from PubChem (CID 63824711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).