C13H11ClN4S — CID 63824711
4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine (PubChem CID 63824711) has the molecular formula C13H11ClN4S and a molecular weight of 290.78 g/mol. Its IUPAC name is 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine.
| Compound Name | 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 63824711 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-chloro-N-[2-(1,3-thiazol-4-yl)ethyl]phthalazin-1-amine |
| SMILES | Clc1nnc(NCCc2cscn2)c2ccccc12 |
| InChI | InChI=1S/C13H11ClN4S/c14-12-10-3-1-2-4-11(10)13(18-17-12)15-6-5-9-7-19-8-16-9/h1-4,7-8H,5-6H2,(H,15,18) |
| InChIKey | CCIRFJLPNRBGFO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |