C15H18ClFN2O — CID 63826513
2-(chloromethyl)-1-(2-cyclopentyloxyethyl)-5-fluorobenzimidazole (PubChem CID 63826513) has the molecular formula C15H18ClFN2O and a molecular weight of 296.77 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2-cyclopentyloxyethyl)-5-fluorobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(2-cyclopentyloxyethyl)-5-fluorobenzimidazole |
|---|---|
| PubChem CID | 63826513 |
| Molecular Formula | C15H18ClFN2O |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-(chloromethyl)-1-(2-cyclopentyloxyethyl)-5-fluorobenzimidazole |
| SMILES | Fc1ccc2c(c1)nc(CCl)n2CCOC1CCCC1 |
| InChI | InChI=1S/C15H18ClFN2O/c16-10-15-18-13-9-11(17)5-6-14(13)19(15)7-8-20-12-3-1-2-4-12/h5-6,9,12H,1-4,7-8,10H2 |
| InChIKey | RNMBAHSCLXZRPW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|