C12H20F3NO4 — CID 63826599
2-methyl-4-oxo-2-propan-2-yl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]butanoic acid (PubChem CID 63826599) has the molecular formula C12H20F3NO4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-methyl-4-oxo-2-propan-2-yl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]butanoic acid.
| Compound Name | 2-methyl-4-oxo-2-propan-2-yl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 63826599 |
| Molecular Formula | C12H20F3NO4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-methyl-4-oxo-2-propan-2-yl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]butanoic acid |
| SMILES | CC(C)C(C)(CC(=O)NCCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H20F3NO4/c1-8(2)11(3,10(18)19)6-9(17)16-4-5-20-7-12(13,14)15/h8H,4-7H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | WKCRVSAQOMMWIZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|