C15H22F3NO2 — CID 63826731
2,6,6-trimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-4H-indol-4-ol (PubChem CID 63826731) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-4H-indol-4-ol.
| Compound Name | 2,6,6-trimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-4H-indol-4-ol |
|---|---|
| PubChem CID | 63826731 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2,6,6-trimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]-5,7-dihydro-4H-indol-4-ol |
| SMILES | Cc1cc2c(n1CCOCC(F)(F)F)CC(C)(C)CC2O |
| InChI | InChI=1S/C15H22F3NO2/c1-10-6-11-12(7-14(2,3)8-13(11)20)19(10)4-5-21-9-15(16,17)18/h6,13,20H,4-5,7-9H2,1-3H3 |
| InChIKey | YXJQLNAELCLQQZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|