C12H16F3NO4 — CID 63828896
6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 63828896) has the molecular formula C12H16F3NO4 and a molecular weight of 295.26 g/mol. Its IUPAC name is 6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 63828896 |
| Molecular Formula | C12H16F3NO4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 6-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO4/c13-12(14,15)7-20-6-5-16-10(17)8-3-1-2-4-9(8)11(18)19/h1-2,8-9H,3-7H2,(H,16,17)(H,18,19) |
| InChIKey | SVYTWEYRGGJAGQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|