C11H16N2O5 — CID 83202392
6-(2-carbamoyloxyethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 83202392) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 6-(2-carbamoyloxyethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(2-carbamoyloxyethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 83202392 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 6-(2-carbamoyloxyethylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | NC(=O)OCCNC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C11H16N2O5/c12-11(17)18-6-5-13-9(14)7-3-1-2-4-8(7)10(15)16/h1-2,7-8H,3-6H2,(H2,12,17)(H,13,14)(H,15,16) |
| InChIKey | ODOVVIUASDGLIS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|