C14H20F3NOS — CID 63829062
N-[cyclopentyl(thiophen-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63829062) has the molecular formula C14H20F3NOS and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63829062 |
| Molecular Formula | C14H20F3NOS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)COCCNC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C14H20F3NOS/c15-14(16,17)10-19-8-7-18-13(11-4-1-2-5-11)12-6-3-9-20-12/h3,6,9,11,13,18H,1-2,4-5,7-8,10H2 |
| InChIKey | IUEGUZCCTJBXPL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|