2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid

C13H25NO3 — CID 63832512

IUPAC2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid
SMILESCC(C)N(CC(=O)O)C(=O)CC(C)C(C)(C)C
InChIInChI=1S/C13H25NO3/c1-9(2)14(8-12(16)17)11(15)7-10(3)13(4,5)6/h9-10H,7-8H2,1-6H3,(H,16,17)
InChIKeyJAAWPGFLUFAZCK-UHFFFAOYSA-N
MW243.35 g/mol
LogP2.38
Rot. Bonds5

About 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid

2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid (PubChem CID 63832512) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid.

Molecular Properties

Compound Name2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid
PubChem CID63832512
Molecular FormulaC13H25NO3
Molecular Weight243.35 g/mol
Exact Mass243.18
IUPAC Name2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid
SMILESCC(C)N(CC(=O)O)C(=O)CC(C)C(C)(C)C
InChIInChI=1S/C13H25NO3/c1-9(2)14(8-12(16)17)11(15)7-10(3)13(4,5)6/h9-10H,7-8H2,1-6H3,(H,16,17)
InChIKeyJAAWPGFLUFAZCK-UHFFFAOYSA-N
XLogP2.38
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.35
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid?
The IUPAC name of 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid (CID 63832512) is 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid.
What is the SMILES notation for 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid?
The canonical SMILES for 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid is CC(C)N(CC(=O)O)C(=O)CC(C)C(C)(C)C.
What is the InChIKey of 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid?
The InChIKey is JAAWPGFLUFAZCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-9(2)14(8-12(16)17)11(15)7-10(3)13(4,5)6/h9-10H,7-8H2,1-6H3,(H,16,17).
What are the key properties of 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid?
2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid has a molecular weight of 243.35 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[propan-2-yl(3,4,4-trimethylpentanoyl)amino]acetic acid is sourced from PubChem (CID 63832512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).