C18H30N2O — CID 63833559
N-[(2-aminophenyl)methyl]-3,4,4-trimethyl-N-propan-2-ylpentanamide (PubChem CID 63833559) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-3,4,4-trimethyl-N-propan-2-ylpentanamide.
| Compound Name | N-[(2-aminophenyl)methyl]-3,4,4-trimethyl-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 63833559 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-3,4,4-trimethyl-N-propan-2-ylpentanamide |
| SMILES | CC(C)N(Cc1ccccc1N)C(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C18H30N2O/c1-13(2)20(12-15-9-7-8-10-16(15)19)17(21)11-14(3)18(4,5)6/h7-10,13-14H,11-12,19H2,1-6H3 |
| InChIKey | KZQRBZYVLOQUEP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|