C12H19F3N2O4 — CID 63833186
2-[1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]piperidin-2-yl]acetic acid (PubChem CID 63833186) has the molecular formula C12H19F3N2O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-[1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 63833186 |
| Molecular Formula | C12H19F3N2O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]piperidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCCN1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O4/c13-12(14,15)8-21-6-4-16-11(20)17-5-2-1-3-9(17)7-10(18)19/h9H,1-8H2,(H,16,20)(H,18,19) |
| InChIKey | OHXBXFWTYPLOTE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|