C19H33NO — CID 63833464
1-(2-methoxyphenyl)-4,5,5-trimethyl-N-propylhexan-2-amine (PubChem CID 63833464) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4,5,5-trimethyl-N-propylhexan-2-amine.
| Compound Name | 1-(2-methoxyphenyl)-4,5,5-trimethyl-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 63833464 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 1-(2-methoxyphenyl)-4,5,5-trimethyl-N-propylhexan-2-amine |
| SMILES | CCCNC(Cc1ccccc1OC)CC(C)C(C)(C)C |
| InChI | InChI=1S/C19H33NO/c1-7-12-20-17(13-15(2)19(3,4)5)14-16-10-8-9-11-18(16)21-6/h8-11,15,17,20H,7,12-14H2,1-6H3 |
| InChIKey | UBTZBPKKEYJYIU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |