About N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide
N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide (PubChem CID 63834715) has the molecular formula C15H29N3O2
and a molecular weight of 283.42 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide.
Molecular Properties
| Compound Name | N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide |
| PubChem CID | 63834715 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide |
| SMILES | CC(CC(=O)N(CC(N)=O)C1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C15H29N3O2/c1-11(15(2,3)4)9-14(20)18(10-13(16)19)12-5-7-17-8-6-12/h11-12,17H,5-10H2,1-4H3,(H2,16,19) |
| InChIKey | QQKFJAZCLZUUTE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide?
The IUPAC name of N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide (CID 63834715) is N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide.
What is the SMILES notation for N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide?
The canonical SMILES for N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide is CC(CC(=O)N(CC(N)=O)C1CCNCC1)C(C)(C)C.
What is the InChIKey of N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide?
The InChIKey is QQKFJAZCLZUUTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O2/c1-11(15(2,3)4)9-14(20)18(10-13(16)19)12-5-7-17-8-6-12/h11-12,17H,5-10H2,1-4H3,(H2,16,19).
What are the key properties of N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide?
N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide has a molecular weight of 283.42 g/mol, XLogP of 1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-oxoethyl)-3,4,4-trimethyl-N-piperidin-4-ylpentanamide is sourced from PubChem (CID 63834715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).