C15H30N2O — CID 79121294
N-(4-aminocyclohexyl)-N,3,4,4-tetramethylpentanamide (PubChem CID 79121294) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-N,3,4,4-tetramethylpentanamide.
| Compound Name | N-(4-aminocyclohexyl)-N,3,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 79121294 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-(4-aminocyclohexyl)-N,3,4,4-tetramethylpentanamide |
| SMILES | CC(CC(=O)N(C)C1CCC(N)CC1)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O/c1-11(15(2,3)4)10-14(18)17(5)13-8-6-12(16)7-9-13/h11-13H,6-10,16H2,1-5H3 |
| InChIKey | BFAFFHPKSDEKNU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |