C12H15NO2S — CID 63835750
6-butylsulfanyl-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 63835750) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 6-butylsulfanyl-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 6-butylsulfanyl-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63835750 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-butylsulfanyl-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CCCCSc1ccc2c(c1)NC(=O)C2O |
| InChI | InChI=1S/C12H15NO2S/c1-2-3-6-16-8-4-5-9-10(7-8)13-12(15)11(9)14/h4-5,7,11,14H,2-3,6H2,1H3,(H,13,15) |
| InChIKey | IFIWOJSEGGLKLK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|